C39H34Br2N2 — CID 142500207
N,N-bis(4-bromophenyl)-10-(1,1,2,3,3-pentamethylisoindol-5-yl)anthracen-9-amine (PubChem CID 142500207) has the molecular formula C39H34Br2N2 and a molecular weight of 690.52 g/mol. Its IUPAC name is N,N-bis(4-bromophenyl)-10-(1,1,2,3,3-pentamethylisoindol-5-yl)anthracen-9-amine.
| Compound Name | N,N-bis(4-bromophenyl)-10-(1,1,2,3,3-pentamethylisoindol-5-yl)anthracen-9-amine |
|---|---|
| PubChem CID | 142500207 |
| Molecular Formula | C39H34Br2N2 |
| Molecular Weight | 690.52 g/mol |
| Exact Mass | 688.11 |
| IUPAC Name | N,N-bis(4-bromophenyl)-10-(1,1,2,3,3-pentamethylisoindol-5-yl)anthracen-9-amine |
| SMILES | CN1C(C)(C)c2ccc(-c3c4ccccc4c(N(c4ccc(Br)cc4)c4ccc(Br)cc4)c4ccccc34)cc2C1(C)C |
| InChI | InChI=1S/C39H34Br2N2/c1-38(2)34-23-14-25(24-35(34)39(3,4)42(38)5)36-30-10-6-8-12-32(30)37(33-13-9-7-11-31(33)36)43(28-19-15-26(40)16-20-28)29-21-17-27(41)18-22-29/h6-24H,1-5H3 |
| InChIKey | SLZBKPYWNJXNKT-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.52 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|