C62H45Br2N — CID 142733125
3,6-dibromo-N,N-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]-10-phenylanthracen-9-amine (PubChem CID 142733125) has the molecular formula C62H45Br2N and a molecular weight of 963.86 g/mol. Its IUPAC name is 3,6-dibromo-N,N-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]-10-phenylanthracen-9-amine.
| Compound Name | 3,6-dibromo-N,N-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]-10-phenylanthracen-9-amine |
|---|---|
| PubChem CID | 142733125 |
| Molecular Formula | C62H45Br2N |
| Molecular Weight | 963.86 g/mol |
| Exact Mass | 961.19 |
| IUPAC Name | 3,6-dibromo-N,N-bis[4-(9,9-dimethylfluoren-2-yl)phenyl]-10-phenylanthracen-9-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccc(N(c4ccc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)cc4)c4c5ccc(Br)cc5c(-c5ccccc5)c5cc(Br)ccc45)cc3)cc21 |
| InChI | InChI=1S/C62H45Br2N/c1-61(2)55-16-10-8-14-47(55)49-30-22-41(34-57(49)61)38-18-26-45(27-19-38)65(46-28-20-39(21-29-46)42-23-31-50-48-15-9-11-17-56(48)62(3,4)58(50)35-42)60-51-32-24-43(63)36-53(51)59(40-12-6-5-7-13-40)54-37-44(64)25-33-52(54)60/h5-37H,1-4H3 |
| InChIKey | CJPWCRBBXIPSKR-UHFFFAOYSA-N |
| XLogP | 18.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.86 |
| LogP ≤ 5 | 18.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|