C39H42N2O2 — CID 89323588
2-hydroxy-5-[10-(2-methoxy-1,1,3,3-tetramethylisoindol-5-yl)anthracen-9-yl]-1,1,3,3-tetramethylisoindole (PubChem CID 89323588) has the molecular formula C39H42N2O2 and a molecular weight of 570.78 g/mol. Its IUPAC name is 2-hydroxy-5-[10-(2-methoxy-1,1,3,3-tetramethylisoindol-5-yl)anthracen-9-yl]-1,1,3,3-tetramethylisoindole.
| Compound Name | 2-hydroxy-5-[10-(2-methoxy-1,1,3,3-tetramethylisoindol-5-yl)anthracen-9-yl]-1,1,3,3-tetramethylisoindole |
|---|---|
| PubChem CID | 89323588 |
| Molecular Formula | C39H42N2O2 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | 2-hydroxy-5-[10-(2-methoxy-1,1,3,3-tetramethylisoindol-5-yl)anthracen-9-yl]-1,1,3,3-tetramethylisoindole |
| SMILES | CON1C(C)(C)c2ccc(-c3c4ccccc4c(-c4ccc5c(c4)C(C)(C)N(O)C5(C)C)c4ccccc34)cc2C1(C)C |
| InChI | InChI=1S/C39H42N2O2/c1-36(2)30-20-18-24(22-32(30)37(3,4)40(36)42)34-26-14-10-12-16-28(26)35(29-17-13-11-15-27(29)34)25-19-21-31-33(23-25)39(7,8)41(43-9)38(31,5)6/h10-23,42H,1-9H3 |
| InChIKey | CQXZPLJDNCXZFH-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|