C25H25NO — CID 102478703
2-methoxy-1,1,3,3-tetramethyl-5-(2-naphthalen-1-ylethynyl)isoindole (PubChem CID 102478703) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-methoxy-1,1,3,3-tetramethyl-5-(2-naphthalen-1-ylethynyl)isoindole.
| Compound Name | 2-methoxy-1,1,3,3-tetramethyl-5-(2-naphthalen-1-ylethynyl)isoindole |
|---|---|
| PubChem CID | 102478703 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-methoxy-1,1,3,3-tetramethyl-5-(2-naphthalen-1-ylethynyl)isoindole |
| SMILES | CON1C(C)(C)c2ccc(C#Cc3cccc4ccccc34)cc2C1(C)C |
| InChI | InChI=1S/C25H25NO/c1-24(2)22-16-14-18(17-23(22)25(3,4)26(24)27-5)13-15-20-11-8-10-19-9-6-7-12-21(19)20/h6-12,14,16-17H,1-5H3 |
| InChIKey | KOMXJFWGVBCVMF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|