C18H12O2 — CID 67420821
3-(2-naphthalen-1-ylethynyl)benzene-1,2-diol (PubChem CID 67420821) has the molecular formula C18H12O2 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-(2-naphthalen-1-ylethynyl)benzene-1,2-diol.
| Compound Name | 3-(2-naphthalen-1-ylethynyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 67420821 |
| Molecular Formula | C18H12O2 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-(2-naphthalen-1-ylethynyl)benzene-1,2-diol |
| SMILES | Oc1cccc(C#Cc2cccc3ccccc23)c1O |
| InChI | InChI=1S/C18H12O2/c19-17-10-4-8-15(18(17)20)12-11-14-7-3-6-13-5-1-2-9-16(13)14/h1-10,19-20H |
| InChIKey | LRSPHWGHBKUMGS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|