About benzene-1,2,3-triol;naphthalene
benzene-1,2,3-triol;naphthalene (PubChem CID 157155506) has the molecular formula C16H14O3
and a molecular weight of 254.28 g/mol. Its IUPAC name is benzene-1,2,3-triol;naphthalene.
Molecular Properties
| Compound Name | benzene-1,2,3-triol;naphthalene |
| PubChem CID | 157155506 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | benzene-1,2,3-triol;naphthalene |
| SMILES | Oc1cccc(O)c1O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C6H6O3/c1-2-6-10-8-4-3-7-9(10)5-1;7-4-2-1-3-5(8)6(4)9/h1-8H;1-3,7-9H |
| InChIKey | ALTIDQBLEAMYKW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2,3-triol;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2,3-triol;naphthalene?
The IUPAC name of benzene-1,2,3-triol;naphthalene (CID 157155506) is benzene-1,2,3-triol;naphthalene.
What is the SMILES notation for benzene-1,2,3-triol;naphthalene?
The canonical SMILES for benzene-1,2,3-triol;naphthalene is Oc1cccc(O)c1O.c1ccc2ccccc2c1.
What is the InChIKey of benzene-1,2,3-triol;naphthalene?
The InChIKey is ALTIDQBLEAMYKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C6H6O3/c1-2-6-10-8-4-3-7-9(10)5-1;7-4-2-1-3-5(8)6(4)9/h1-8H;1-3,7-9H.
What are the key properties of benzene-1,2,3-triol;naphthalene?
benzene-1,2,3-triol;naphthalene has a molecular weight of 254.28 g/mol, XLogP of 3.64, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2,3-triol;naphthalene is sourced from PubChem (CID 157155506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).