C42H39Br2NO — CID 142500623
N,N-bis(4-bromophenyl)-10-(1,1,3,3-tetraethyl-2-benzofuran-5-yl)anthracen-9-amine (PubChem CID 142500623) has the molecular formula C42H39Br2NO and a molecular weight of 733.59 g/mol. Its IUPAC name is N,N-bis(4-bromophenyl)-10-(1,1,3,3-tetraethyl-2-benzofuran-5-yl)anthracen-9-amine.
| Compound Name | N,N-bis(4-bromophenyl)-10-(1,1,3,3-tetraethyl-2-benzofuran-5-yl)anthracen-9-amine |
|---|---|
| PubChem CID | 142500623 |
| Molecular Formula | C42H39Br2NO |
| Molecular Weight | 733.59 g/mol |
| Exact Mass | 731.14 |
| IUPAC Name | N,N-bis(4-bromophenyl)-10-(1,1,3,3-tetraethyl-2-benzofuran-5-yl)anthracen-9-amine |
| SMILES | CCC1(CC)OC(CC)(CC)c2cc(-c3c4ccccc4c(N(c4ccc(Br)cc4)c4ccc(Br)cc4)c4ccccc34)ccc21 |
| InChI | InChI=1S/C42H39Br2NO/c1-5-41(6-2)37-26-17-28(27-38(37)42(7-3,8-4)46-41)39-33-13-9-11-15-35(33)40(36-16-12-10-14-34(36)39)45(31-22-18-29(43)19-23-31)32-24-20-30(44)21-25-32/h9-27H,5-8H2,1-4H3 |
| InChIKey | UKNGSSIEVKQWOE-UHFFFAOYSA-N |
| XLogP | 13.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.59 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|