C33H34N2O2 — CID 158800895
5-[[2-[(5-hydroxy-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)methylideneamino]-4-propylphenyl]iminomethyl]tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-4-ol (PubChem CID 158800895) has the molecular formula C33H34N2O2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 5-[[2-[(5-hydroxy-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)methylideneamino]-4-propylphenyl]iminomethyl]tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-4-ol.
| Compound Name | 5-[[2-[(5-hydroxy-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)methylideneamino]-4-propylphenyl]iminomethyl]tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 158800895 |
| Molecular Formula | C33H34N2O2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 5-[[2-[(5-hydroxy-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)methylideneamino]-4-propylphenyl]iminomethyl]tricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-4-ol |
| SMILES | CCCc1ccc(/N=C/c2cc3c(cc2O)C2CCC3C2)c(/N=C/c2cc3c(cc2O)C2CCC3C2)c1 |
| InChI | InChI=1S/C33H34N2O2/c1-2-3-19-4-9-30(34-17-24-13-26-20-5-7-22(11-20)28(26)15-32(24)36)31(10-19)35-18-25-14-27-21-6-8-23(12-21)29(27)16-33(25)37/h4,9-10,13-18,20-23,36-37H,2-3,5-8,11-12H2,1H3/b34-17+,35-18+ |
| InChIKey | GGFNDWNNGNMAIU-JZFGTTBJSA-N |
| XLogP | 8.28 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|