C14H19NO — CID 19900296
1-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol (PubChem CID 19900296) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol.
| Compound Name | 1-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol |
|---|---|
| PubChem CID | 19900296 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol |
| SMILES | CC(O)C1=CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C14H19NO/c1-12(16)14-7-9-15(10-8-14)11-13-5-3-2-4-6-13/h2-7,12,16H,8-11H2,1H3 |
| InChIKey | BFESWSFXYASHBD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|