C20H19N — CID 11821785
1-benzyl-4-(2-phenylethynyl)-3,6-dihydro-2H-pyridine (PubChem CID 11821785) has the molecular formula C20H19N and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-benzyl-4-(2-phenylethynyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-benzyl-4-(2-phenylethynyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 11821785 |
| Molecular Formula | C20H19N |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-benzyl-4-(2-phenylethynyl)-3,6-dihydro-2H-pyridine |
| SMILES | C(#Cc1ccccc1)C1=CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H19N/c1-3-7-18(8-4-1)11-12-19-13-15-21(16-14-19)17-20-9-5-2-6-10-20/h1-10,13H,14-17H2 |
| InChIKey | MHPFYZACLUEXBM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|