About 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane
2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane (PubChem CID 143581792) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane.
Molecular Properties
| Compound Name | 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane |
| PubChem CID | 143581792 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane |
| SMILES | CC.OCCC1=CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C14H19NO.C2H6/c16-11-8-13-6-9-15(10-7-13)12-14-4-2-1-3-5-14;1-2/h1-6,16H,7-12H2;1-2H3 |
| InChIKey | ONEDDQFWBJJZSW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane?
The IUPAC name of 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane (CID 143581792) is 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane.
What is the SMILES notation for 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane?
The canonical SMILES for 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane is CC.OCCC1=CCN(Cc2ccccc2)CC1.
What is the InChIKey of 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane?
The InChIKey is ONEDDQFWBJJZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO.C2H6/c16-11-8-13-6-9-15(10-7-13)12-14-4-2-1-3-5-14;1-2/h1-6,16H,7-12H2;1-2H3.
What are the key properties of 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane?
2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane has a molecular weight of 247.38 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanol;ethane is sourced from PubChem (CID 143581792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).