C17H29Cl3N2 — CID 75485433
2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine;2-chloropropane;dihydrochloride (PubChem CID 75485433) has the molecular formula C17H29Cl3N2 and a molecular weight of 367.79 g/mol. Its IUPAC name is 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine;2-chloropropane;dihydrochloride.
| Compound Name | 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine;2-chloropropane;dihydrochloride |
|---|---|
| PubChem CID | 75485433 |
| Molecular Formula | C17H29Cl3N2 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine;2-chloropropane;dihydrochloride |
| SMILES | CC(C)Cl.Cl.Cl.NCCC1=CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C14H20N2.C3H7Cl.2ClH/c15-9-6-13-7-10-16(11-8-13)12-14-4-2-1-3-5-14;1-3(2)4;;/h1-5,7H,6,8-12,15H2;3H,1-2H3;2*1H |
| InChIKey | TXVXVIHZLFQTOJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|