C9H18N2 — CID 117205610
2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine (PubChem CID 117205610) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine.
| Compound Name | 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine |
|---|---|
| PubChem CID | 117205610 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2-(1-ethyl-3,6-dihydro-2H-pyridin-4-yl)ethanamine |
| SMILES | CCN1CC=C(CCN)CC1 |
| InChI | InChI=1S/C9H18N2/c1-2-11-7-4-9(3-6-10)5-8-11/h4H,2-3,5-8,10H2,1H3 |
| InChIKey | YOAFKQNDPJAPPN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|