C18H27NO2 — CID 156719785
1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol (PubChem CID 156719785) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol.
| Compound Name | 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol |
|---|---|
| PubChem CID | 156719785 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol |
| SMILES | COC1=CCN(Cc2ccccc2)CC1.OCC1CCC1 |
| InChI | InChI=1S/C13H17NO.C5H10O/c1-15-13-7-9-14(10-8-13)11-12-5-3-2-4-6-12;6-4-5-2-1-3-5/h2-7H,8-11H2,1H3;5-6H,1-4H2 |
| InChIKey | WVBXLMWCYNRFKC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |