About 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol
1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol (PubChem CID 156719785) has the molecular formula C18H27NO2
and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol.
Molecular Properties
| Compound Name | 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol |
| PubChem CID | 156719785 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol |
| SMILES | COC1=CCN(Cc2ccccc2)CC1.OCC1CCC1 |
| InChI | InChI=1S/C13H17NO.C5H10O/c1-15-13-7-9-14(10-8-13)11-12-5-3-2-4-6-12;6-4-5-2-1-3-5/h2-7H,8-11H2,1H3;5-6H,1-4H2 |
| InChIKey | WVBXLMWCYNRFKC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol?
The IUPAC name of 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol (CID 156719785) is 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol.
What is the SMILES notation for 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol?
The canonical SMILES for 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol is COC1=CCN(Cc2ccccc2)CC1.OCC1CCC1.
What is the InChIKey of 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol?
The InChIKey is WVBXLMWCYNRFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO.C5H10O/c1-15-13-7-9-14(10-8-13)11-12-5-3-2-4-6-12;6-4-5-2-1-3-5/h2-7H,8-11H2,1H3;5-6H,1-4H2.
What are the key properties of 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol?
1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol has a molecular weight of 289.42 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-methoxy-3,6-dihydro-2H-pyridine;cyclobutylmethanol is sourced from PubChem (CID 156719785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).