C17H23NO — CID 159320689
1-benzyl-4-(3-methylcyclobutyl)oxy-3,6-dihydro-2H-pyridine (PubChem CID 159320689) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-benzyl-4-(3-methylcyclobutyl)oxy-3,6-dihydro-2H-pyridine.
| Compound Name | 1-benzyl-4-(3-methylcyclobutyl)oxy-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 159320689 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 1-benzyl-4-(3-methylcyclobutyl)oxy-3,6-dihydro-2H-pyridine |
| SMILES | CC1CC(OC2=CCN(Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C17H23NO/c1-14-11-17(12-14)19-16-7-9-18(10-8-16)13-15-5-3-2-4-6-15/h2-7,14,17H,8-13H2,1H3 |
| InChIKey | JVKAURCGLFUHHM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |