C19H33N3O — CID 142177909
(9-benzyl-1,5-dimethyl-1,5,9-triazacyclododec-3-yl)methanol (PubChem CID 142177909) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is (9-benzyl-1,5-dimethyl-1,5,9-triazacyclododec-3-yl)methanol.
| Compound Name | (9-benzyl-1,5-dimethyl-1,5,9-triazacyclododec-3-yl)methanol |
|---|---|
| PubChem CID | 142177909 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | (9-benzyl-1,5-dimethyl-1,5,9-triazacyclododec-3-yl)methanol |
| SMILES | CN1CCCN(Cc2ccccc2)CCCN(C)CC(CO)C1 |
| InChI | InChI=1S/C19H33N3O/c1-20-10-6-12-22(16-18-8-4-3-5-9-18)13-7-11-21(2)15-19(14-20)17-23/h3-5,8-9,19,23H,6-7,10-17H2,1-2H3 |
| InChIKey | SZADPKUCUPFLSF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |