C34H52Cl2N2O4 — CID 21433905
[5,5-dimethyl-8-(3-methyloctan-2-yl)-2-prop-2-ynyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-morpholin-4-ylbutanoate;dihydrochloride (PubChem CID 21433905) has the molecular formula C34H52Cl2N2O4 and a molecular weight of 623.71 g/mol. Its IUPAC name is [5,5-dimethyl-8-(3-methyloctan-2-yl)-2-prop-2-ynyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-morpholin-4-ylbutanoate;dihydrochloride.
| Compound Name | [5,5-dimethyl-8-(3-methyloctan-2-yl)-2-prop-2-ynyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-morpholin-4-ylbutanoate;dihydrochloride |
|---|---|
| PubChem CID | 21433905 |
| Molecular Formula | C34H52Cl2N2O4 |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | [5,5-dimethyl-8-(3-methyloctan-2-yl)-2-prop-2-ynyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-morpholin-4-ylbutanoate;dihydrochloride |
| SMILES | C#CCN1CCC2=C(C1)c1c(OC(=O)CCCN3CCOCC3)cc(C(C)C(C)CCCCC)cc1OC2(C)C.Cl.Cl |
| InChI | InChI=1S/C34H50N2O4.2ClH/c1-7-9-10-12-25(3)26(4)27-22-30(39-32(37)13-11-16-35-18-20-38-21-19-35)33-28-24-36(15-8-2)17-14-29(28)34(5,6)40-31(33)23-27;;/h2,22-23,25-26H,7,9-21,24H2,1,3-6H3;2*1H |
| InChIKey | RWVWWHCWIRLKGW-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|