C36H54N2O3 — CID 88822071
[5,5-dimethyl-8-(3-methyloctyl)-2-prop-2-ynyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-(2-methylpiperidin-1-yl)butanoate (PubChem CID 88822071) has the molecular formula C36H54N2O3 and a molecular weight of 562.84 g/mol. Its IUPAC name is [5,5-dimethyl-8-(3-methyloctyl)-2-prop-2-ynyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-(2-methylpiperidin-1-yl)butanoate.
| Compound Name | [5,5-dimethyl-8-(3-methyloctyl)-2-prop-2-ynyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-(2-methylpiperidin-1-yl)butanoate |
|---|---|
| PubChem CID | 88822071 |
| Molecular Formula | C36H54N2O3 |
| Molecular Weight | 562.84 g/mol |
| Exact Mass | 562.41 |
| IUPAC Name | [5,5-dimethyl-8-(3-methyloctyl)-2-prop-2-ynyl-3,4-dihydro-1H-chromeno[4,3-c]pyridin-10-yl] 4-(2-methylpiperidin-1-yl)butanoate |
| SMILES | C#CCN1CCC2=C(C1)c1c(OC(=O)CCCN3CCCCC3C)cc(CCC(C)CCCCC)cc1OC2(C)C |
| InChI | InChI=1S/C36H54N2O3/c1-7-9-10-14-27(3)17-18-29-24-32(40-34(39)16-13-22-38-21-12-11-15-28(38)4)35-30-26-37(20-8-2)23-19-31(30)36(5,6)41-33(35)25-29/h2,24-25,27-28H,7,9-23,26H2,1,3-6H3 |
| InChIKey | NFXUROHETWRKDU-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.84 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|