C26H34O4 — CID 19848760
[4-(1-hydroxypropan-2-yl)-2-methyl-7-(5-phenylpentan-2-yl)-3,4-dihydro-2H-chromen-5-yl] acetate (PubChem CID 19848760) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is [4-(1-hydroxypropan-2-yl)-2-methyl-7-(5-phenylpentan-2-yl)-3,4-dihydro-2H-chromen-5-yl] acetate.
| Compound Name | [4-(1-hydroxypropan-2-yl)-2-methyl-7-(5-phenylpentan-2-yl)-3,4-dihydro-2H-chromen-5-yl] acetate |
|---|---|
| PubChem CID | 19848760 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | [4-(1-hydroxypropan-2-yl)-2-methyl-7-(5-phenylpentan-2-yl)-3,4-dihydro-2H-chromen-5-yl] acetate |
| SMILES | CC(=O)Oc1cc(C(C)CCCc2ccccc2)cc2c1C(C(C)CO)CC(C)O2 |
| InChI | InChI=1S/C26H34O4/c1-17(9-8-12-21-10-6-5-7-11-21)22-14-24-26(25(15-22)30-20(4)28)23(18(2)16-27)13-19(3)29-24/h5-7,10-11,14-15,17-19,23,27H,8-9,12-13,16H2,1-4H3 |
| InChIKey | KUVJANXTLWASLU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|