C29H38N2O4 — CID 70542685
[(6S,6aR,9R)-9-acetamido-6-methyl-3-(5-phenylpentan-2-yloxy)-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-1-yl] acetate (PubChem CID 70542685) has the molecular formula C29H38N2O4 and a molecular weight of 478.63 g/mol. Its IUPAC name is [(6S,6aR,9R)-9-acetamido-6-methyl-3-(5-phenylpentan-2-yloxy)-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-1-yl] acetate.
| Compound Name | [(6S,6aR,9R)-9-acetamido-6-methyl-3-(5-phenylpentan-2-yloxy)-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-1-yl] acetate |
|---|---|
| PubChem CID | 70542685 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | [(6S,6aR,9R)-9-acetamido-6-methyl-3-(5-phenylpentan-2-yloxy)-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-1-yl] acetate |
| SMILES | CC(=O)N[C@@H]1CC[C@@H]2C(C1)c1c(cc(OC(C)CCCc3ccccc3)cc1OC(C)=O)N[C@H]2C |
| InChI | InChI=1S/C29H38N2O4/c1-18(9-8-12-22-10-6-5-7-11-22)34-24-16-27-29(28(17-24)35-21(4)33)26-15-23(31-20(3)32)13-14-25(26)19(2)30-27/h5-7,10-11,16-19,23,25-26,30H,8-9,12-15H2,1-4H3,(H,31,32)/t18?,19-,23+,25-,26?/m0/s1 |
| InChIKey | PUQHIDATFGZGGE-WOEXNYLSSA-N |
| XLogP | 5.60 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|