C23H31NO3 — CID 70491557
(2R,4S)-2-[2-hydroxy-4-(5-phenylpentan-2-yloxy)phenyl]-1-methylpiperidin-4-ol (PubChem CID 70491557) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (2R,4S)-2-[2-hydroxy-4-(5-phenylpentan-2-yloxy)phenyl]-1-methylpiperidin-4-ol.
| Compound Name | (2R,4S)-2-[2-hydroxy-4-(5-phenylpentan-2-yloxy)phenyl]-1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 70491557 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (2R,4S)-2-[2-hydroxy-4-(5-phenylpentan-2-yloxy)phenyl]-1-methylpiperidin-4-ol |
| SMILES | CC(CCCc1ccccc1)Oc1ccc([C@H]2C[C@@H](O)CCN2C)c(O)c1 |
| InChI | InChI=1S/C23H31NO3/c1-17(7-6-10-18-8-4-3-5-9-18)27-20-11-12-21(23(26)16-20)22-15-19(25)13-14-24(22)2/h3-5,8-9,11-12,16-17,19,22,25-26H,6-7,10,13-15H2,1-2H3/t17?,19-,22+/m0/s1 |
| InChIKey | FAMAWLSNUFDNNW-BRPLTFKJSA-N |
| XLogP | 4.31 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|