C28H31NO3 — CID 88616541
(4aS)-9-hydroxy-11-[(2R)-5-phenylpentan-2-yl]oxy-1,2,3,4,4a,6-hexahydropyrido[1,2-f]phenanthridin-7-one (PubChem CID 88616541) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is (4aS)-9-hydroxy-11-[(2R)-5-phenylpentan-2-yl]oxy-1,2,3,4,4a,6-hexahydropyrido[1,2-f]phenanthridin-7-one.
| Compound Name | (4aS)-9-hydroxy-11-[(2R)-5-phenylpentan-2-yl]oxy-1,2,3,4,4a,6-hexahydropyrido[1,2-f]phenanthridin-7-one |
|---|---|
| PubChem CID | 88616541 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (4aS)-9-hydroxy-11-[(2R)-5-phenylpentan-2-yl]oxy-1,2,3,4,4a,6-hexahydropyrido[1,2-f]phenanthridin-7-one |
| SMILES | C[C@H](CCCc1ccccc1)Oc1ccc2c(c1)=C1C(O)=CC(=O)CN1[C@H]1CCCCC=21 |
| InChI | InChI=1S/C28H31NO3/c1-19(8-7-11-20-9-3-2-4-10-20)32-22-14-15-23-24-12-5-6-13-26(24)29-18-21(30)16-27(31)28(29)25(23)17-22/h2-4,9-10,14-17,19,26,31H,5-8,11-13,18H2,1H3/t19-,26+/m1/s1 |
| InChIKey | BAGZUPRJOJWCJB-BCHFMIIMSA-N |
| XLogP | 4.02 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |