C27H31NO4 — CID 70375008
6,8-dihydroxy-10-(5-phenylpentan-2-yloxy)-3,4a,5,6,7,12b-hexahydro-2H-pyrrolo[1,2-f]phenanthridin-1-one (PubChem CID 70375008) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 6,8-dihydroxy-10-(5-phenylpentan-2-yloxy)-3,4a,5,6,7,12b-hexahydro-2H-pyrrolo[1,2-f]phenanthridin-1-one.
| Compound Name | 6,8-dihydroxy-10-(5-phenylpentan-2-yloxy)-3,4a,5,6,7,12b-hexahydro-2H-pyrrolo[1,2-f]phenanthridin-1-one |
|---|---|
| PubChem CID | 70375008 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 6,8-dihydroxy-10-(5-phenylpentan-2-yloxy)-3,4a,5,6,7,12b-hexahydro-2H-pyrrolo[1,2-f]phenanthridin-1-one |
| SMILES | CC(CCCc1ccccc1)Oc1ccc2c(c1)C1=C(O)CC(O)CC1N1CCC(=O)C21 |
| InChI | InChI=1S/C27H31NO4/c1-17(6-5-9-18-7-3-2-4-8-18)32-20-10-11-21-22(16-20)26-23(14-19(29)15-25(26)31)28-13-12-24(30)27(21)28/h2-4,7-8,10-11,16-17,19,23,27,29,31H,5-6,9,12-15H2,1H3 |
| InChIKey | BLLFMCKZDQMODV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |