C27H33NO4 — CID 22812608
[(6aR,10aS)-5-methyl-9-oxo-3-(5-phenylpentan-2-yloxy)-6,6a,7,8,10,10a-hexahydrophenanthridin-1-yl] acetate (PubChem CID 22812608) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is [(6aR,10aS)-5-methyl-9-oxo-3-(5-phenylpentan-2-yloxy)-6,6a,7,8,10,10a-hexahydrophenanthridin-1-yl] acetate.
| Compound Name | [(6aR,10aS)-5-methyl-9-oxo-3-(5-phenylpentan-2-yloxy)-6,6a,7,8,10,10a-hexahydrophenanthridin-1-yl] acetate |
|---|---|
| PubChem CID | 22812608 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | [(6aR,10aS)-5-methyl-9-oxo-3-(5-phenylpentan-2-yloxy)-6,6a,7,8,10,10a-hexahydrophenanthridin-1-yl] acetate |
| SMILES | CC(=O)Oc1cc(OC(C)CCCc2ccccc2)cc2c1[C@H]1CC(=O)CC[C@H]1CN2C |
| InChI | InChI=1S/C27H33NO4/c1-18(8-7-11-20-9-5-4-6-10-20)31-23-15-25-27(26(16-23)32-19(2)29)24-14-22(30)13-12-21(24)17-28(25)3/h4-6,9-10,15-16,18,21,24H,7-8,11-14,17H2,1-3H3/t18?,21-,24-/m0/s1 |
| InChIKey | MXLLQMLXIOAOJL-ZCAYSAGXSA-N |
| XLogP | 5.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|