C26H36N2O4S — CID 22818806
N-[(6aR,10aR)-1-hydroxy-5-methyl-3-(5-phenylpentan-2-yloxy)-6a,7,8,9,10,10a-hexahydro-6H-phenanthridin-9-yl]methanesulfonamide (PubChem CID 22818806) has the molecular formula C26H36N2O4S and a molecular weight of 472.65 g/mol. Its IUPAC name is N-[(6aR,10aR)-1-hydroxy-5-methyl-3-(5-phenylpentan-2-yloxy)-6a,7,8,9,10,10a-hexahydro-6H-phenanthridin-9-yl]methanesulfonamide.
| Compound Name | N-[(6aR,10aR)-1-hydroxy-5-methyl-3-(5-phenylpentan-2-yloxy)-6a,7,8,9,10,10a-hexahydro-6H-phenanthridin-9-yl]methanesulfonamide |
|---|---|
| PubChem CID | 22818806 |
| Molecular Formula | C26H36N2O4S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | N-[(6aR,10aR)-1-hydroxy-5-methyl-3-(5-phenylpentan-2-yloxy)-6a,7,8,9,10,10a-hexahydro-6H-phenanthridin-9-yl]methanesulfonamide |
| SMILES | CC(CCCc1ccccc1)Oc1cc(O)c2c(c1)N(C)C[C@@H]1CCC(NS(C)(=O)=O)C[C@@H]21 |
| InChI | InChI=1S/C26H36N2O4S/c1-18(8-7-11-19-9-5-4-6-10-19)32-22-15-24-26(25(29)16-22)23-14-21(27-33(3,30)31)13-12-20(23)17-28(24)2/h4-6,9-10,15-16,18,20-21,23,27,29H,7-8,11-14,17H2,1-3H3/t18?,20-,21?,23+/m0/s1 |
| InChIKey | QFFXQXJHSAFYDL-RRTYHCDHSA-N |
| XLogP | 4.43 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |