C25H33NO3 — CID 56629758
(3aR,5R)-5-(2-hydroxyethyl)-8-[(2S)-5-phenylpentan-2-yl]oxy-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinolin-6-ol (PubChem CID 56629758) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is (3aR,5R)-5-(2-hydroxyethyl)-8-[(2S)-5-phenylpentan-2-yl]oxy-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinolin-6-ol.
| Compound Name | (3aR,5R)-5-(2-hydroxyethyl)-8-[(2S)-5-phenylpentan-2-yl]oxy-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinolin-6-ol |
|---|---|
| PubChem CID | 56629758 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | (3aR,5R)-5-(2-hydroxyethyl)-8-[(2S)-5-phenylpentan-2-yl]oxy-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinolin-6-ol |
| SMILES | C[C@@H](CCCc1ccccc1)Oc1cc(O)c2c(c1)N1CCC[C@@H]1C[C@@H]2CCO |
| InChI | InChI=1S/C25H33NO3/c1-18(7-5-10-19-8-3-2-4-9-19)29-22-16-23-25(24(28)17-22)20(12-14-27)15-21-11-6-13-26(21)23/h2-4,8-9,16-18,20-21,27-28H,5-7,10-15H2,1H3/t18-,20-,21+/m0/s1 |
| InChIKey | HFKPRFUDRAEKKQ-SESVDKBCSA-N |
| XLogP | 5.02 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |