C26H36O4 — CID 19848829
3-(4-hydroxybutyl)-2,2-dimethyl-7-(5-phenylpentan-2-yloxy)-3,4-dihydrochromen-5-ol (PubChem CID 19848829) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is 3-(4-hydroxybutyl)-2,2-dimethyl-7-(5-phenylpentan-2-yloxy)-3,4-dihydrochromen-5-ol.
| Compound Name | 3-(4-hydroxybutyl)-2,2-dimethyl-7-(5-phenylpentan-2-yloxy)-3,4-dihydrochromen-5-ol |
|---|---|
| PubChem CID | 19848829 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 3-(4-hydroxybutyl)-2,2-dimethyl-7-(5-phenylpentan-2-yloxy)-3,4-dihydrochromen-5-ol |
| SMILES | CC(CCCc1ccccc1)Oc1cc(O)c2c(c1)OC(C)(C)C(CCCCO)C2 |
| InChI | InChI=1S/C26H36O4/c1-19(10-9-13-20-11-5-4-6-12-20)29-22-17-24(28)23-16-21(14-7-8-15-27)26(2,3)30-25(23)18-22/h4-6,11-12,17-19,21,27-28H,7-10,13-16H2,1-3H3 |
| InChIKey | VNMLJUWVNHGLQL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|