C35H45NO6 — CID 70375001
4-[[11-acetamido-3-(5-phenylpentan-2-yloxy)-4b,5,6,7,8,8a,8b,9,10,11,12,12a-dodecahydrotriphenylen-1-yl]oxy]-4-oxobutanoic acid (PubChem CID 70375001) has the molecular formula C35H45NO6 and a molecular weight of 575.75 g/mol. Its IUPAC name is 4-[[11-acetamido-3-(5-phenylpentan-2-yloxy)-4b,5,6,7,8,8a,8b,9,10,11,12,12a-dodecahydrotriphenylen-1-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[11-acetamido-3-(5-phenylpentan-2-yloxy)-4b,5,6,7,8,8a,8b,9,10,11,12,12a-dodecahydrotriphenylen-1-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70375001 |
| Molecular Formula | C35H45NO6 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | 4-[[11-acetamido-3-(5-phenylpentan-2-yloxy)-4b,5,6,7,8,8a,8b,9,10,11,12,12a-dodecahydrotriphenylen-1-yl]oxy]-4-oxobutanoic acid |
| SMILES | CC(=O)NC1CCC2C(C1)c1c(OC(=O)CCC(=O)O)cc(OC(C)CCCc3ccccc3)cc1C1CCCCC12 |
| InChI | InChI=1S/C35H45NO6/c1-22(9-8-12-24-10-4-3-5-11-24)41-26-20-31-28-14-7-6-13-27(28)29-16-15-25(36-23(2)37)19-30(29)35(31)32(21-26)42-34(40)18-17-33(38)39/h3-5,10-11,20-22,25,27-30H,6-9,12-19H2,1-2H3,(H,36,37)(H,38,39) |
| InChIKey | HIHWHCVUCDKLHG-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|