C27H36ClNO4 — CID 70532227
[(6S,6aR,9R,10aR)-9-hydroxy-6-methyl-3-(5-phenylpentoxy)-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-1-yl] acetate;hydrochloride (PubChem CID 70532227) has the molecular formula C27H36ClNO4 and a molecular weight of 474.04 g/mol. Its IUPAC name is [(6S,6aR,9R,10aR)-9-hydroxy-6-methyl-3-(5-phenylpentoxy)-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-1-yl] acetate;hydrochloride.
| Compound Name | [(6S,6aR,9R,10aR)-9-hydroxy-6-methyl-3-(5-phenylpentoxy)-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-1-yl] acetate;hydrochloride |
|---|---|
| PubChem CID | 70532227 |
| Molecular Formula | C27H36ClNO4 |
| Molecular Weight | 474.04 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | [(6S,6aR,9R,10aR)-9-hydroxy-6-methyl-3-(5-phenylpentoxy)-5,6,6a,7,8,9,10,10a-octahydrophenanthridin-1-yl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1cc(OCCCCCc2ccccc2)cc2c1[C@@H]1C[C@H](O)CC[C@H]1[C@H](C)N2.Cl |
| InChI | InChI=1S/C27H35NO4.ClH/c1-18-23-13-12-21(30)15-24(23)27-25(28-18)16-22(17-26(27)32-19(2)29)31-14-8-4-7-11-20-9-5-3-6-10-20;/h3,5-6,9-10,16-18,21,23-24,28,30H,4,7-8,11-15H2,1-2H3;1H/t18-,21+,23-,24+;/m0./s1 |
| InChIKey | GKNCTACPVAZTPR-SGXCSFLVSA-N |
| XLogP | 5.88 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.04 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|