C30H37NO4 — CID 70375149
[(4aR,7S)-7-hydroxy-11-[(2R)-5-phenylpentan-2-yl]oxy-2,3,4,4a,6,7,8,9b-octahydro-1H-pyrido[1,2-f]phenanthridin-9-yl] acetate (PubChem CID 70375149) has the molecular formula C30H37NO4 and a molecular weight of 475.63 g/mol. Its IUPAC name is [(4aR,7S)-7-hydroxy-11-[(2R)-5-phenylpentan-2-yl]oxy-2,3,4,4a,6,7,8,9b-octahydro-1H-pyrido[1,2-f]phenanthridin-9-yl] acetate.
| Compound Name | [(4aR,7S)-7-hydroxy-11-[(2R)-5-phenylpentan-2-yl]oxy-2,3,4,4a,6,7,8,9b-octahydro-1H-pyrido[1,2-f]phenanthridin-9-yl] acetate |
|---|---|
| PubChem CID | 70375149 |
| Molecular Formula | C30H37NO4 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | [(4aR,7S)-7-hydroxy-11-[(2R)-5-phenylpentan-2-yl]oxy-2,3,4,4a,6,7,8,9b-octahydro-1H-pyrido[1,2-f]phenanthridin-9-yl] acetate |
| SMILES | CC(=O)OC1=C2C3C=C(O[C@H](C)CCCc4ccccc4)C=CC3=C3CCCC[C@H]3N2C[C@@H](O)C1 |
| InChI | InChI=1S/C30H37NO4/c1-20(9-8-12-22-10-4-3-5-11-22)34-24-15-16-25-26-13-6-7-14-28(26)31-19-23(33)17-29(35-21(2)32)30(31)27(25)18-24/h3-5,10-11,15-16,18,20,23,27-28,33H,6-9,12-14,17,19H2,1-2H3/t20-,23+,27?,28-/m1/s1 |
| InChIKey | FCUYHLKHAGWMDV-PEHJRXASSA-N |
| XLogP | 5.58 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |