C29H36N2O4 — CID 70511116
[(4aS,7R)-7-hydroxy-11-[3-(1-pyridin-2-ylethoxy)propyl]-2,3,4,4a,6,7,8,9b-octahydro-1H-pyrido[1,2-f]phenanthridin-9-yl] acetate (PubChem CID 70511116) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is [(4aS,7R)-7-hydroxy-11-[3-(1-pyridin-2-ylethoxy)propyl]-2,3,4,4a,6,7,8,9b-octahydro-1H-pyrido[1,2-f]phenanthridin-9-yl] acetate.
| Compound Name | [(4aS,7R)-7-hydroxy-11-[3-(1-pyridin-2-ylethoxy)propyl]-2,3,4,4a,6,7,8,9b-octahydro-1H-pyrido[1,2-f]phenanthridin-9-yl] acetate |
|---|---|
| PubChem CID | 70511116 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | [(4aS,7R)-7-hydroxy-11-[3-(1-pyridin-2-ylethoxy)propyl]-2,3,4,4a,6,7,8,9b-octahydro-1H-pyrido[1,2-f]phenanthridin-9-yl] acetate |
| SMILES | CC(=O)OC1=C2C3C=C(CCCOC(C)c4ccccn4)C=CC3=C3CCCC[C@@H]3N2C[C@H](O)C1 |
| InChI | InChI=1S/C29H36N2O4/c1-19(26-10-5-6-14-30-26)34-15-7-8-21-12-13-23-24-9-3-4-11-27(24)31-18-22(33)17-28(35-20(2)32)29(31)25(23)16-21/h5-6,10,12-14,16,19,22,25,27,33H,3-4,7-9,11,15,17-18H2,1-2H3/t19?,22-,25?,27+/m1/s1 |
| InChIKey | XXHUABKRRIUIHD-OSNFLOTKSA-N |
| XLogP | 5.15 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|