C23H29NO3 — CID 70565887
(8-heptyl-5,5-dimethylchromeno[4,3-c]pyridin-10-yl) acetate (PubChem CID 70565887) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (8-heptyl-5,5-dimethylchromeno[4,3-c]pyridin-10-yl) acetate.
| Compound Name | (8-heptyl-5,5-dimethylchromeno[4,3-c]pyridin-10-yl) acetate |
|---|---|
| PubChem CID | 70565887 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (8-heptyl-5,5-dimethylchromeno[4,3-c]pyridin-10-yl) acetate |
| SMILES | CCCCCCCc1cc(OC(C)=O)c2c(c1)OC(C)(C)c1ccncc1-2 |
| InChI | InChI=1S/C23H29NO3/c1-5-6-7-8-9-10-17-13-20(26-16(2)25)22-18-15-24-12-11-19(18)23(3,4)27-21(22)14-17/h11-15H,5-10H2,1-4H3 |
| InChIKey | XFIXOSNRPZADKG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|