C19H17NO3 — CID 51039827
methyl 3,3-dimethyl-7H-pyrano[2,3-c]carbazole-10-carboxylate (PubChem CID 51039827) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl 3,3-dimethyl-7H-pyrano[2,3-c]carbazole-10-carboxylate.
| Compound Name | methyl 3,3-dimethyl-7H-pyrano[2,3-c]carbazole-10-carboxylate |
|---|---|
| PubChem CID | 51039827 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | methyl 3,3-dimethyl-7H-pyrano[2,3-c]carbazole-10-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3ccc4c(c3c2c1)C=CC(C)(C)O4 |
| InChI | InChI=1S/C19H17NO3/c1-19(2)9-8-12-16(23-19)7-6-15-17(12)13-10-11(18(21)22-3)4-5-14(13)20-15/h4-10,20H,1-3H3 |
| InChIKey | PCLJYOVKGSBXJW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |