C12H10BrF2NO2 — CID 152674651
methyl 2-bromo-3-(2,2-difluoroethyl)-1H-indole-5-carboxylate (PubChem CID 152674651) has the molecular formula C12H10BrF2NO2 and a molecular weight of 318.12 g/mol. Its IUPAC name is methyl 2-bromo-3-(2,2-difluoroethyl)-1H-indole-5-carboxylate.
| Compound Name | methyl 2-bromo-3-(2,2-difluoroethyl)-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 152674651 |
| Molecular Formula | C12H10BrF2NO2 |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | methyl 2-bromo-3-(2,2-difluoroethyl)-1H-indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c(Br)c(CC(F)F)c2c1 |
| InChI | InChI=1S/C12H10BrF2NO2/c1-18-12(17)6-2-3-9-7(4-6)8(5-10(14)15)11(13)16-9/h2-4,10,16H,5H2,1H3 |
| InChIKey | ZMGTWMLSSGMVAU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |