C21H31N2O3+ — CID 6995828
dibutyl-[(6-methoxycarbonyl-2-methyl-4-oxo-1H-quinolin-3-yl)methyl]azanium (PubChem CID 6995828) has the molecular formula C21H31N2O3+ and a molecular weight of 359.49 g/mol. Its IUPAC name is dibutyl-[(6-methoxycarbonyl-2-methyl-4-oxo-1H-quinolin-3-yl)methyl]azanium.
| Compound Name | dibutyl-[(6-methoxycarbonyl-2-methyl-4-oxo-1H-quinolin-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 6995828 |
| Molecular Formula | C21H31N2O3+ |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | dibutyl-[(6-methoxycarbonyl-2-methyl-4-oxo-1H-quinolin-3-yl)methyl]azanium |
| SMILES | CCCC[NH+](CCCC)Cc1c(C)[nH]c2ccc(C(=O)OC)cc2c1=O |
| InChI | InChI=1S/C21H30N2O3/c1-5-7-11-23(12-8-6-2)14-18-15(3)22-19-10-9-16(21(25)26-4)13-17(19)20(18)24/h9-10,13H,5-8,11-12,14H2,1-4H3,(H,22,24)/p+1 |
| InChIKey | HVBIJGHVSUPGJF-UHFFFAOYSA-O |
| XLogP | 2.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |