C19H28FN2O+ — CID 4245000
dibutyl-[(6-fluoro-2-methyl-4-oxo-1H-quinolin-3-yl)methyl]azanium (PubChem CID 4245000) has the molecular formula C19H28FN2O+ and a molecular weight of 319.44 g/mol. Its IUPAC name is dibutyl-[(6-fluoro-2-methyl-4-oxo-1H-quinolin-3-yl)methyl]azanium.
| Compound Name | dibutyl-[(6-fluoro-2-methyl-4-oxo-1H-quinolin-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 4245000 |
| Molecular Formula | C19H28FN2O+ |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.22 |
| IUPAC Name | dibutyl-[(6-fluoro-2-methyl-4-oxo-1H-quinolin-3-yl)methyl]azanium |
| SMILES | CCCC[NH+](CCCC)Cc1c(C)[nH]c2ccc(F)cc2c1=O |
| InChI | InChI=1S/C19H27FN2O/c1-4-6-10-22(11-7-5-2)13-17-14(3)21-18-9-8-15(20)12-16(18)19(17)23/h8-9,12H,4-7,10-11,13H2,1-3H3,(H,21,23)/p+1 |
| InChIKey | FXABBGBYASTRFO-UHFFFAOYSA-O |
| XLogP | 2.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |