C19H27N2O3+ — CID 5014178
butyl-ethyl-[(6-methoxycarbonyl-2-methyl-4-oxo-1H-quinolin-3-yl)methyl]azanium (PubChem CID 5014178) has the molecular formula C19H27N2O3+ and a molecular weight of 331.44 g/mol. Its IUPAC name is butyl-ethyl-[(6-methoxycarbonyl-2-methyl-4-oxo-1H-quinolin-3-yl)methyl]azanium.
| Compound Name | butyl-ethyl-[(6-methoxycarbonyl-2-methyl-4-oxo-1H-quinolin-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 5014178 |
| Molecular Formula | C19H27N2O3+ |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | butyl-ethyl-[(6-methoxycarbonyl-2-methyl-4-oxo-1H-quinolin-3-yl)methyl]azanium |
| SMILES | CCCC[NH+](CC)Cc1c(C)[nH]c2ccc(C(=O)OC)cc2c1=O |
| InChI | InChI=1S/C19H26N2O3/c1-5-7-10-21(6-2)12-16-13(3)20-17-9-8-14(19(23)24-4)11-15(17)18(16)22/h8-9,11H,5-7,10,12H2,1-4H3,(H,20,22)/p+1 |
| InChIKey | BTIAOWLIJRQCHG-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |