C19H25N2O3+ — CID 4605637
methyl 2-methyl-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-1H-quinoline-6-carboxylate (PubChem CID 4605637) has the molecular formula C19H25N2O3+ and a molecular weight of 329.42 g/mol. Its IUPAC name is methyl 2-methyl-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-1H-quinoline-6-carboxylate.
| Compound Name | methyl 2-methyl-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-1H-quinoline-6-carboxylate |
|---|---|
| PubChem CID | 4605637 |
| Molecular Formula | C19H25N2O3+ |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | methyl 2-methyl-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-1H-quinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c(C)c(C[NH+]3CCC(C)CC3)c(=O)c2c1 |
| InChI | InChI=1S/C19H24N2O3/c1-12-6-8-21(9-7-12)11-16-13(2)20-17-5-4-14(19(23)24-3)10-15(17)18(16)22/h4-5,10,12H,6-9,11H2,1-3H3,(H,20,22)/p+1 |
| InChIKey | QJYKFVXMYOIKAL-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |