C19H28N3O+ — CID 7212957
6-(dimethylamino)-2-methyl-3-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]-1H-quinolin-4-one (PubChem CID 7212957) has the molecular formula C19H28N3O+ and a molecular weight of 314.45 g/mol. Its IUPAC name is 6-(dimethylamino)-2-methyl-3-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]-1H-quinolin-4-one.
| Compound Name | 6-(dimethylamino)-2-methyl-3-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 7212957 |
| Molecular Formula | C19H28N3O+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 6-(dimethylamino)-2-methyl-3-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]-1H-quinolin-4-one |
| SMILES | Cc1[nH]c2ccc(N(C)C)cc2c(=O)c1C[NH+]1CCC[C@H](C)C1 |
| InChI | InChI=1S/C19H27N3O/c1-13-6-5-9-22(11-13)12-17-14(2)20-18-8-7-15(21(3)4)10-16(18)19(17)23/h7-8,10,13H,5-6,9,11-12H2,1-4H3,(H,20,23)/p+1/t13-/m0/s1 |
| InChIKey | XCHYXSOBLQFCNN-ZDUSSCGKSA-O |
| XLogP | 1.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |