C17H24N3O2+ — CID 5216381
6-(dimethylamino)-2-methyl-3-(morpholin-4-ium-4-ylmethyl)-1H-quinolin-4-one (PubChem CID 5216381) has the molecular formula C17H24N3O2+ and a molecular weight of 302.40 g/mol. Its IUPAC name is 6-(dimethylamino)-2-methyl-3-(morpholin-4-ium-4-ylmethyl)-1H-quinolin-4-one.
| Compound Name | 6-(dimethylamino)-2-methyl-3-(morpholin-4-ium-4-ylmethyl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 5216381 |
| Molecular Formula | C17H24N3O2+ |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 6-(dimethylamino)-2-methyl-3-(morpholin-4-ium-4-ylmethyl)-1H-quinolin-4-one |
| SMILES | Cc1[nH]c2ccc(N(C)C)cc2c(=O)c1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C17H23N3O2/c1-12-15(11-20-6-8-22-9-7-20)17(21)14-10-13(19(2)3)4-5-16(14)18-12/h4-5,10H,6-9,11H2,1-3H3,(H,18,21)/p+1 |
| InChIKey | ZYZAWARCVPKIPD-UHFFFAOYSA-O |
| XLogP | 0.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |