C21H30N3O2+ — CID 7212941
2-methyl-3-[[(3R)-3-methylpiperidin-1-ium-1-yl]methyl]-6-morpholin-4-yl-1H-quinolin-4-one (PubChem CID 7212941) has the molecular formula C21H30N3O2+ and a molecular weight of 356.49 g/mol. Its IUPAC name is 2-methyl-3-[[(3R)-3-methylpiperidin-1-ium-1-yl]methyl]-6-morpholin-4-yl-1H-quinolin-4-one.
| Compound Name | 2-methyl-3-[[(3R)-3-methylpiperidin-1-ium-1-yl]methyl]-6-morpholin-4-yl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 7212941 |
| Molecular Formula | C21H30N3O2+ |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 2-methyl-3-[[(3R)-3-methylpiperidin-1-ium-1-yl]methyl]-6-morpholin-4-yl-1H-quinolin-4-one |
| SMILES | Cc1[nH]c2ccc(N3CCOCC3)cc2c(=O)c1C[NH+]1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C21H29N3O2/c1-15-4-3-7-23(13-15)14-19-16(2)22-20-6-5-17(12-18(20)21(19)25)24-8-10-26-11-9-24/h5-6,12,15H,3-4,7-11,13-14H2,1-2H3,(H,22,25)/p+1/t15-/m1/s1 |
| InChIKey | LQVDIVZYLMWQAS-OAHLLOKOSA-O |
| XLogP | 1.49 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |