C19H27N2O2+ — CID 3252291
6-ethoxy-2-methyl-3-[(3-methylpiperidin-1-ium-1-yl)methyl]-1H-quinolin-4-one (PubChem CID 3252291) has the molecular formula C19H27N2O2+ and a molecular weight of 315.44 g/mol. Its IUPAC name is 6-ethoxy-2-methyl-3-[(3-methylpiperidin-1-ium-1-yl)methyl]-1H-quinolin-4-one.
| Compound Name | 6-ethoxy-2-methyl-3-[(3-methylpiperidin-1-ium-1-yl)methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 3252291 |
| Molecular Formula | C19H27N2O2+ |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 6-ethoxy-2-methyl-3-[(3-methylpiperidin-1-ium-1-yl)methyl]-1H-quinolin-4-one |
| SMILES | CCOc1ccc2[nH]c(C)c(C[NH+]3CCCC(C)C3)c(=O)c2c1 |
| InChI | InChI=1S/C19H26N2O2/c1-4-23-15-7-8-18-16(10-15)19(22)17(14(3)20-18)12-21-9-5-6-13(2)11-21/h7-8,10,13H,4-6,9,11-12H2,1-3H3,(H,20,22)/p+1 |
| InChIKey | UQPLCFSKTZPBLJ-UHFFFAOYSA-O |
| XLogP | 2.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |