C18H25N2O2+ — CID 3601199
6-methoxy-2-methyl-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-1H-quinolin-4-one (PubChem CID 3601199) has the molecular formula C18H25N2O2+ and a molecular weight of 301.41 g/mol. Its IUPAC name is 6-methoxy-2-methyl-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-1H-quinolin-4-one.
| Compound Name | 6-methoxy-2-methyl-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 3601199 |
| Molecular Formula | C18H25N2O2+ |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 6-methoxy-2-methyl-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-1H-quinolin-4-one |
| SMILES | COc1ccc2[nH]c(C)c(C[NH+]3CCC(C)CC3)c(=O)c2c1 |
| InChI | InChI=1S/C18H24N2O2/c1-12-6-8-20(9-7-12)11-16-13(2)19-17-5-4-14(22-3)10-15(17)18(16)21/h4-5,10,12H,6-9,11H2,1-3H3,(H,19,21)/p+1 |
| InChIKey | IXKMEAVFDWIZDA-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |