C21H29N2O3+ — CID 4220962
propyl 2-methyl-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-1H-quinoline-6-carboxylate (PubChem CID 4220962) has the molecular formula C21H29N2O3+ and a molecular weight of 357.47 g/mol. Its IUPAC name is propyl 2-methyl-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-1H-quinoline-6-carboxylate.
| Compound Name | propyl 2-methyl-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-1H-quinoline-6-carboxylate |
|---|---|
| PubChem CID | 4220962 |
| Molecular Formula | C21H29N2O3+ |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | propyl 2-methyl-3-[(4-methylpiperidin-1-ium-1-yl)methyl]-4-oxo-1H-quinoline-6-carboxylate |
| SMILES | CCCOC(=O)c1ccc2[nH]c(C)c(C[NH+]3CCC(C)CC3)c(=O)c2c1 |
| InChI | InChI=1S/C21H28N2O3/c1-4-11-26-21(25)16-5-6-19-17(12-16)20(24)18(15(3)22-19)13-23-9-7-14(2)8-10-23/h5-6,12,14H,4,7-11,13H2,1-3H3,(H,22,24)/p+1 |
| InChIKey | MFAUSTDDNGMOEN-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |