C18H23N2O3+ — CID 4614042
ethyl 2-methyl-4-oxo-3-(pyrrolidin-1-ium-1-ylmethyl)-1H-quinoline-6-carboxylate (PubChem CID 4614042) has the molecular formula C18H23N2O3+ and a molecular weight of 315.39 g/mol. Its IUPAC name is ethyl 2-methyl-4-oxo-3-(pyrrolidin-1-ium-1-ylmethyl)-1H-quinoline-6-carboxylate.
| Compound Name | ethyl 2-methyl-4-oxo-3-(pyrrolidin-1-ium-1-ylmethyl)-1H-quinoline-6-carboxylate |
|---|---|
| PubChem CID | 4614042 |
| Molecular Formula | C18H23N2O3+ |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | ethyl 2-methyl-4-oxo-3-(pyrrolidin-1-ium-1-ylmethyl)-1H-quinoline-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2[nH]c(C)c(C[NH+]3CCCC3)c(=O)c2c1 |
| InChI | InChI=1S/C18H22N2O3/c1-3-23-18(22)13-6-7-16-14(10-13)17(21)15(12(2)19-16)11-20-8-4-5-9-20/h6-7,10H,3-5,8-9,11H2,1-2H3,(H,19,21)/p+1 |
| InChIKey | RJKGQOROSOIPAJ-UHFFFAOYSA-O |
| XLogP | 1.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |