C15H22N3O+ — CID 4621806
[6-(dimethylamino)-2-methyl-4-oxo-1H-quinolin-3-yl]methyl-dimethylazanium (PubChem CID 4621806) has the molecular formula C15H22N3O+ and a molecular weight of 260.36 g/mol. Its IUPAC name is [6-(dimethylamino)-2-methyl-4-oxo-1H-quinolin-3-yl]methyl-dimethylazanium.
| Compound Name | [6-(dimethylamino)-2-methyl-4-oxo-1H-quinolin-3-yl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 4621806 |
| Molecular Formula | C15H22N3O+ |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [6-(dimethylamino)-2-methyl-4-oxo-1H-quinolin-3-yl]methyl-dimethylazanium |
| SMILES | Cc1[nH]c2ccc(N(C)C)cc2c(=O)c1C[NH+](C)C |
| InChI | InChI=1S/C15H21N3O/c1-10-13(9-17(2)3)15(19)12-8-11(18(4)5)6-7-14(12)16-10/h6-8H,9H2,1-5H3,(H,16,19)/p+1 |
| InChIKey | IQCHPJVHDROZJZ-UHFFFAOYSA-O |
| XLogP | 0.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |