C17H26N3O+ — CID 4250011
[6-(diethylamino)-2-methyl-4-oxo-1H-quinolin-3-yl]methyl-dimethylazanium (PubChem CID 4250011) has the molecular formula C17H26N3O+ and a molecular weight of 288.42 g/mol. Its IUPAC name is [6-(diethylamino)-2-methyl-4-oxo-1H-quinolin-3-yl]methyl-dimethylazanium.
| Compound Name | [6-(diethylamino)-2-methyl-4-oxo-1H-quinolin-3-yl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 4250011 |
| Molecular Formula | C17H26N3O+ |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | [6-(diethylamino)-2-methyl-4-oxo-1H-quinolin-3-yl]methyl-dimethylazanium |
| SMILES | CCN(CC)c1ccc2[nH]c(C)c(C[NH+](C)C)c(=O)c2c1 |
| InChI | InChI=1S/C17H25N3O/c1-6-20(7-2)13-8-9-16-14(10-13)17(21)15(11-19(4)5)12(3)18-16/h8-10H,6-7,11H2,1-5H3,(H,18,21)/p+1 |
| InChIKey | PHZHACCOOLQSKV-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |