C17H24BrN2O+ — CID 5076053
(6-bromo-2-methyl-4-oxo-1H-quinolin-3-yl)methyl-butyl-ethylazanium (PubChem CID 5076053) has the molecular formula C17H24BrN2O+ and a molecular weight of 352.30 g/mol. Its IUPAC name is (6-bromo-2-methyl-4-oxo-1H-quinolin-3-yl)methyl-butyl-ethylazanium.
| Compound Name | (6-bromo-2-methyl-4-oxo-1H-quinolin-3-yl)methyl-butyl-ethylazanium |
|---|---|
| PubChem CID | 5076053 |
| Molecular Formula | C17H24BrN2O+ |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (6-bromo-2-methyl-4-oxo-1H-quinolin-3-yl)methyl-butyl-ethylazanium |
| SMILES | CCCC[NH+](CC)Cc1c(C)[nH]c2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C17H23BrN2O/c1-4-6-9-20(5-2)11-15-12(3)19-16-8-7-13(18)10-14(16)17(15)21/h7-8,10H,4-6,9,11H2,1-3H3,(H,19,21)/p+1 |
| InChIKey | UCOXSEPSZDYGLK-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |