C18H24BrN3O — CID 1189714
6-bromo-2-methyl-3-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]-1H-quinolin-4-one (PubChem CID 1189714) has the molecular formula C18H24BrN3O and a molecular weight of 378.31 g/mol. Its IUPAC name is 6-bromo-2-methyl-3-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]-1H-quinolin-4-one.
| Compound Name | 6-bromo-2-methyl-3-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 1189714 |
| Molecular Formula | C18H24BrN3O |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 6-bromo-2-methyl-3-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]-1H-quinolin-4-one |
| SMILES | Cc1[nH]c2ccc(Br)cc2c(=O)c1CN(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C18H24BrN3O/c1-12-16(11-22(3)14-6-8-21(2)9-7-14)18(23)15-10-13(19)4-5-17(15)20-12/h4-5,10,14H,6-9,11H2,1-3H3,(H,20,23) |
| InChIKey | CAYRNZFPLBIQLS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |