C21H33N2O2+ — CID 3433637
(6-butoxy-2-methyl-4-oxo-1H-quinolin-3-yl)methyl-butyl-ethylazanium (PubChem CID 3433637) has the molecular formula C21H33N2O2+ and a molecular weight of 345.51 g/mol. Its IUPAC name is (6-butoxy-2-methyl-4-oxo-1H-quinolin-3-yl)methyl-butyl-ethylazanium.
| Compound Name | (6-butoxy-2-methyl-4-oxo-1H-quinolin-3-yl)methyl-butyl-ethylazanium |
|---|---|
| PubChem CID | 3433637 |
| Molecular Formula | C21H33N2O2+ |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | (6-butoxy-2-methyl-4-oxo-1H-quinolin-3-yl)methyl-butyl-ethylazanium |
| SMILES | CCCCOc1ccc2[nH]c(C)c(C[NH+](CC)CCCC)c(=O)c2c1 |
| InChI | InChI=1S/C21H32N2O2/c1-5-8-12-23(7-3)15-19-16(4)22-20-11-10-17(25-13-9-6-2)14-18(20)21(19)24/h10-11,14H,5-9,12-13,15H2,1-4H3,(H,22,24)/p+1 |
| InChIKey | NQNHYJNHDLSUFR-UHFFFAOYSA-O |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|